C10H12N4O3 — CID 171901473
5-(3-cyano-1,2-dihydroxypropyl)pyridine-3-carbohydrazide (PubChem CID 171901473) has the molecular formula C10H12N4O3 and a molecular weight of 236.23 g/mol. Its IUPAC name is 5-(3-cyano-1,2-dihydroxypropyl)pyridine-3-carbohydrazide.
| Compound Name | 5-(3-cyano-1,2-dihydroxypropyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 171901473 |
| Molecular Formula | C10H12N4O3 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 5-(3-cyano-1,2-dihydroxypropyl)pyridine-3-carbohydrazide |
| SMILES | N#CCC(O)C(O)c1cncc(C(=O)NN)c1 |
| InChI | InChI=1S/C10H12N4O3/c11-2-1-8(15)9(16)6-3-7(5-13-4-6)10(17)14-12/h3-5,8-9,15-16H,1,12H2,(H,14,17) |
| InChIKey | UAQVUUDJFHSSFL-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 132.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|