C13H17NO6 — CID 171900062
methyl 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-4-methoxybenzoate (PubChem CID 171900062) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-4-methoxybenzoate.
| Compound Name | methyl 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 171900062 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | methyl 3-(4-amino-1,2-dihydroxy-4-oxobutyl)-4-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC)c(C(O)C(O)CC(N)=O)c1 |
| InChI | InChI=1S/C13H17NO6/c1-19-10-4-3-7(13(18)20-2)5-8(10)12(17)9(15)6-11(14)16/h3-5,9,12,15,17H,6H2,1-2H3,(H2,14,16) |
| InChIKey | VVQSRNFNMGSDQK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |