C13H17NO7 — CID 171900112
4-(4-amino-1,2-dihydroxy-4-oxobutyl)-3,5-dimethoxybenzoic acid (PubChem CID 171900112) has the molecular formula C13H17NO7 and a molecular weight of 299.28 g/mol. Its IUPAC name is 4-(4-amino-1,2-dihydroxy-4-oxobutyl)-3,5-dimethoxybenzoic acid.
| Compound Name | 4-(4-amino-1,2-dihydroxy-4-oxobutyl)-3,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 171900112 |
| Molecular Formula | C13H17NO7 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-(4-amino-1,2-dihydroxy-4-oxobutyl)-3,5-dimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(OC)c1C(O)C(O)CC(N)=O |
| InChI | InChI=1S/C13H17NO7/c1-20-8-3-6(13(18)19)4-9(21-2)11(8)12(17)7(15)5-10(14)16/h3-4,7,12,15,17H,5H2,1-2H3,(H2,14,16)(H,18,19) |
| InChIKey | WUYILNZOZOZSIT-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |