C15H11N3O11 — CID 87858244
[4-[3-(4-hydroxy-2,6-dinitrooxyphenyl)-3-oxopropyl]phenyl] nitrate (PubChem CID 87858244) has the molecular formula C15H11N3O11 and a molecular weight of 409.26 g/mol. Its IUPAC name is [4-[3-(4-hydroxy-2,6-dinitrooxyphenyl)-3-oxopropyl]phenyl] nitrate.
| Compound Name | [4-[3-(4-hydroxy-2,6-dinitrooxyphenyl)-3-oxopropyl]phenyl] nitrate |
|---|---|
| PubChem CID | 87858244 |
| Molecular Formula | C15H11N3O11 |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | [4-[3-(4-hydroxy-2,6-dinitrooxyphenyl)-3-oxopropyl]phenyl] nitrate |
| SMILES | O=C(CCc1ccc(O[N+](=O)[O-])cc1)c1c(O[N+](=O)[O-])cc(O)cc1O[N+](=O)[O-] |
| InChI | InChI=1S/C15H11N3O11/c19-10-7-13(28-17(23)24)15(14(8-10)29-18(25)26)12(20)6-3-9-1-4-11(5-2-9)27-16(21)22/h1-2,4-5,7-8,19H,3,6H2 |
| InChIKey | QQYVPVKUGZCIPF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 194.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|