C17H15NO7 — CID 4088365
[3,5-dihydroxy-2-[3-(4-nitrophenyl)propanoyl]phenyl] acetate (PubChem CID 4088365) has the molecular formula C17H15NO7 and a molecular weight of 345.31 g/mol. Its IUPAC name is [3,5-dihydroxy-2-[3-(4-nitrophenyl)propanoyl]phenyl] acetate.
| Compound Name | [3,5-dihydroxy-2-[3-(4-nitrophenyl)propanoyl]phenyl] acetate |
|---|---|
| PubChem CID | 4088365 |
| Molecular Formula | C17H15NO7 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [3,5-dihydroxy-2-[3-(4-nitrophenyl)propanoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cc(O)cc(O)c1C(=O)CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15NO7/c1-10(19)25-16-9-13(20)8-15(22)17(16)14(21)7-4-11-2-5-12(6-3-11)18(23)24/h2-3,5-6,8-9,20,22H,4,7H2,1H3 |
| InChIKey | PUAVLYKEJPNJQE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|