C14H18F2O3 — CID 66734188
butyl 3-(3,5-difluoro-4-methoxyphenyl)propanoate (PubChem CID 66734188) has the molecular formula C14H18F2O3 and a molecular weight of 272.29 g/mol. Its IUPAC name is butyl 3-(3,5-difluoro-4-methoxyphenyl)propanoate.
| Compound Name | butyl 3-(3,5-difluoro-4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 66734188 |
| Molecular Formula | C14H18F2O3 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | butyl 3-(3,5-difluoro-4-methoxyphenyl)propanoate |
| SMILES | CCCCOC(=O)CCc1cc(F)c(OC)c(F)c1 |
| InChI | InChI=1S/C14H18F2O3/c1-3-4-7-19-13(17)6-5-10-8-11(15)14(18-2)12(16)9-10/h8-9H,3-7H2,1-2H3 |
| InChIKey | MZJUPTRKTQIEEH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|