C26H31NO7 — CID 176564386
3-(3,4,5-trimethoxyphenyl)propyl (3R)-1-(2-oxo-3-phenylpropanoyl)pyrrolidine-3-carboxylate (PubChem CID 176564386) has the molecular formula C26H31NO7 and a molecular weight of 469.53 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)propyl (3R)-1-(2-oxo-3-phenylpropanoyl)pyrrolidine-3-carboxylate.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)propyl (3R)-1-(2-oxo-3-phenylpropanoyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 176564386 |
| Molecular Formula | C26H31NO7 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)propyl (3R)-1-(2-oxo-3-phenylpropanoyl)pyrrolidine-3-carboxylate |
| SMILES | COc1cc(CCCOC(=O)[C@@H]2CCN(C(=O)C(=O)Cc3ccccc3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C26H31NO7/c1-31-22-15-19(16-23(32-2)24(22)33-3)10-7-13-34-26(30)20-11-12-27(17-20)25(29)21(28)14-18-8-5-4-6-9-18/h4-6,8-9,15-16,20H,7,10-14,17H2,1-3H3/t20-/m1/s1 |
| InChIKey | DGWASGXVBWLFRM-HXUWFJFHSA-N |
| XLogP | 2.85 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|