(3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate

C17H23NO4 — CID 60529591

IUPAC(3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate
SMILESCCCC(=O)N1CCCC1C(=O)OCc1cccc(OC)c1
InChIInChI=1S/C17H23NO4/c1-3-6-16(19)18-10-5-9-15(18)17(20)22-12-13-7-4-8-14(11-13)21-2/h4,7-8,11,15H,3,5-6,9-10,12H2,1-2H3
InChIKeyJFUINIBJWHQIGZ-UHFFFAOYSA-N
MW305.37 g/mol
LogP2.53
Rot. Bonds6

About (3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate

(3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate (PubChem CID 60529591) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate.

Molecular Properties

Compound Name(3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate
PubChem CID60529591
Molecular FormulaC17H23NO4
Molecular Weight305.37 g/mol
Exact Mass305.16
IUPAC Name(3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate
SMILESCCCC(=O)N1CCCC1C(=O)OCc1cccc(OC)c1
InChIInChI=1S/C17H23NO4/c1-3-6-16(19)18-10-5-9-15(18)17(20)22-12-13-7-4-8-14(11-13)21-2/h4,7-8,11,15H,3,5-6,9-10,12H2,1-2H3
InChIKeyJFUINIBJWHQIGZ-UHFFFAOYSA-N
XLogP2.53
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.37
LogP ≤ 52.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate?
The IUPAC name of (3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate (CID 60529591) is (3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate.
What is the SMILES notation for (3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate?
The canonical SMILES for (3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate is CCCC(=O)N1CCCC1C(=O)OCc1cccc(OC)c1.
What is the InChIKey of (3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate?
The InChIKey is JFUINIBJWHQIGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4/c1-3-6-16(19)18-10-5-9-15(18)17(20)22-12-13-7-4-8-14(11-13)21-2/h4,7-8,11,15H,3,5-6,9-10,12H2,1-2H3.
What are the key properties of (3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate?
(3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate has a molecular weight of 305.37 g/mol, XLogP of 2.53, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl 1-butanoylpyrrolidine-2-carboxylate is sourced from PubChem (CID 60529591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).