C21H30N2O4 — CID 124822736
ethyl (2R)-1-[2-[(2S)-2-(3-methoxyphenyl)pyrrolidin-1-yl]acetyl]piperidine-2-carboxylate (PubChem CID 124822736) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is ethyl (2R)-1-[2-[(2S)-2-(3-methoxyphenyl)pyrrolidin-1-yl]acetyl]piperidine-2-carboxylate.
| Compound Name | ethyl (2R)-1-[2-[(2S)-2-(3-methoxyphenyl)pyrrolidin-1-yl]acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 124822736 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | ethyl (2R)-1-[2-[(2S)-2-(3-methoxyphenyl)pyrrolidin-1-yl]acetyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCCN1C(=O)CN1CCC[C@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C21H30N2O4/c1-3-27-21(25)19-10-4-5-13-23(19)20(24)15-22-12-7-11-18(22)16-8-6-9-17(14-16)26-2/h6,8-9,14,18-19H,3-5,7,10-13,15H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | BGAPWPUUTJRBTK-RBUKOAKNSA-N |
| XLogP | 2.78 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |