C15H19NO6 — CID 174236608
(2R,4S)-2-(methoxymethoxycarbonyl)-4-phenylmethoxypyrrolidine-1-carboxylic acid (PubChem CID 174236608) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is (2R,4S)-2-(methoxymethoxycarbonyl)-4-phenylmethoxypyrrolidine-1-carboxylic acid.
| Compound Name | (2R,4S)-2-(methoxymethoxycarbonyl)-4-phenylmethoxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174236608 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2R,4S)-2-(methoxymethoxycarbonyl)-4-phenylmethoxypyrrolidine-1-carboxylic acid |
| SMILES | COCOC(=O)[C@H]1C[C@H](OCc2ccccc2)CN1C(=O)O |
| InChI | InChI=1S/C15H19NO6/c1-20-10-22-14(17)13-7-12(8-16(13)15(18)19)21-9-11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3,(H,18,19)/t12-,13+/m0/s1 |
| InChIKey | JWMHTITZVCYMLR-QWHCGFSZSA-N |
| XLogP | 1.47 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|