C13H16N2O5 — CID 66870327
4-aminooxy-2-phenylmethoxycarbonylpyrrolidine-1-carboxylic acid (PubChem CID 66870327) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-aminooxy-2-phenylmethoxycarbonylpyrrolidine-1-carboxylic acid.
| Compound Name | 4-aminooxy-2-phenylmethoxycarbonylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66870327 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-aminooxy-2-phenylmethoxycarbonylpyrrolidine-1-carboxylic acid |
| SMILES | NOC1CC(C(=O)OCc2ccccc2)N(C(=O)O)C1 |
| InChI | InChI=1S/C13H16N2O5/c14-20-10-6-11(15(7-10)13(17)18)12(16)19-8-9-4-2-1-3-5-9/h1-5,10-11H,6-8,14H2,(H,17,18) |
| InChIKey | ZDTPEZZUZNNLEX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|