C29H27NO6 — CID 132525700
dibenzyl (2S,4R)-4-(4-ethenylbenzoyl)oxypyrrolidine-1,2-dicarboxylate (PubChem CID 132525700) has the molecular formula C29H27NO6 and a molecular weight of 485.54 g/mol. Its IUPAC name is dibenzyl (2S,4R)-4-(4-ethenylbenzoyl)oxypyrrolidine-1,2-dicarboxylate.
| Compound Name | dibenzyl (2S,4R)-4-(4-ethenylbenzoyl)oxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 132525700 |
| Molecular Formula | C29H27NO6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | dibenzyl (2S,4R)-4-(4-ethenylbenzoyl)oxypyrrolidine-1,2-dicarboxylate |
| SMILES | C=Cc1ccc(C(=O)O[C@@H]2C[C@@H](C(=O)OCc3ccccc3)N(C(=O)OCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C29H27NO6/c1-2-21-13-15-24(16-14-21)27(31)36-25-17-26(28(32)34-19-22-9-5-3-6-10-22)30(18-25)29(33)35-20-23-11-7-4-8-12-23/h2-16,25-26H,1,17-20H2/t25-,26+/m1/s1 |
| InChIKey | DMLXHLNWBYPWDL-FTJBHMTQSA-N |
| XLogP | 5.01 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|