C25H28BrNO6 — CID 101487265
dibenzyl (2S,4R)-4-(5-bromopentanoyloxy)pyrrolidine-1,2-dicarboxylate (PubChem CID 101487265) has the molecular formula C25H28BrNO6 and a molecular weight of 518.40 g/mol. Its IUPAC name is dibenzyl (2S,4R)-4-(5-bromopentanoyloxy)pyrrolidine-1,2-dicarboxylate.
| Compound Name | dibenzyl (2S,4R)-4-(5-bromopentanoyloxy)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101487265 |
| Molecular Formula | C25H28BrNO6 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | dibenzyl (2S,4R)-4-(5-bromopentanoyloxy)pyrrolidine-1,2-dicarboxylate |
| SMILES | O=C(CCCCBr)O[C@@H]1C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C25H28BrNO6/c26-14-8-7-13-23(28)33-21-15-22(24(29)31-17-19-9-3-1-4-10-19)27(16-21)25(30)32-18-20-11-5-2-6-12-20/h1-6,9-12,21-22H,7-8,13-18H2/t21-,22+/m1/s1 |
| InChIKey | FAJOORSLVYYNPQ-YADHBBJMSA-N |
| XLogP | 4.62 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|