C13H15NO4 — CID 90217678
(2S,4R)-2-formyl-4-phenylmethoxypyrrolidine-1-carboxylic acid (PubChem CID 90217678) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2S,4R)-2-formyl-4-phenylmethoxypyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4R)-2-formyl-4-phenylmethoxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90217678 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2S,4R)-2-formyl-4-phenylmethoxypyrrolidine-1-carboxylic acid |
| SMILES | O=C[C@@H]1C[C@@H](OCc2ccccc2)CN1C(=O)O |
| InChI | InChI=1S/C13H15NO4/c15-8-11-6-12(7-14(11)13(16)17)18-9-10-4-2-1-3-5-10/h1-5,8,11-12H,6-7,9H2,(H,16,17)/t11-,12+/m0/s1 |
| InChIKey | VNNYZVVBIKNKAX-NWDGAFQWSA-N |
| XLogP | 1.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|