C19H30NO4Si — CID 22393499
CID 22393499 (PubChem CID 22393499) has the molecular formula C19H30NO4Si and a molecular weight of 364.54 g/mol.
| Compound Name | CID 22393499 |
|---|---|
| PubChem CID | 22393499 |
| Molecular Formula | C19H30NO4Si |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC(C1CC(OCc2ccccc2)CN1C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C19H30NO4Si/c1-19(2,3)17(24-25(4)5)16-11-15(12-20(16)18(21)22)23-13-14-9-7-6-8-10-14/h6-10,15-17H,11-13H2,1-5H3,(H,21,22) |
| InChIKey | HNRSHPHKWYMSTO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|