C8H14N2O4 — CID 175981935
4-(ethylamino)pyrrolidine-1,2-dicarboxylic acid (PubChem CID 175981935) has the molecular formula C8H14N2O4 and a molecular weight of 202.21 g/mol. Its IUPAC name is 4-(ethylamino)pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | 4-(ethylamino)pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 175981935 |
| Molecular Formula | C8H14N2O4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 4-(ethylamino)pyrrolidine-1,2-dicarboxylic acid |
| SMILES | CCNC1CC(C(=O)O)N(C(=O)O)C1 |
| InChI | InChI=1S/C8H14N2O4/c1-2-9-5-3-6(7(11)12)10(4-5)8(13)14/h5-6,9H,2-4H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | YAUFQUPJGAQUHN-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |