C7H9F2NO4 — CID 175571168
(2R)-4-(difluoromethyl)pyrrolidine-1,2-dicarboxylic acid (PubChem CID 175571168) has the molecular formula C7H9F2NO4 and a molecular weight of 209.15 g/mol. Its IUPAC name is (2R)-4-(difluoromethyl)pyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2R)-4-(difluoromethyl)pyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 175571168 |
| Molecular Formula | C7H9F2NO4 |
| Molecular Weight | 209.15 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | (2R)-4-(difluoromethyl)pyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1CC(C(F)F)CN1C(=O)O |
| InChI | InChI=1S/C7H9F2NO4/c8-5(9)3-1-4(6(11)12)10(2-3)7(13)14/h3-5H,1-2H2,(H,11,12)(H,13,14)/t3?,4-/m1/s1 |
| InChIKey | ZOSOFKAPUSHYOU-SRBOSORUSA-N |
| XLogP | 0.70 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |