C11H19FN2O2 — CID 176638856
tert-butyl (5R)-1-fluoro-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 176638856) has the molecular formula C11H19FN2O2 and a molecular weight of 230.28 g/mol. Its IUPAC name is tert-butyl (5R)-1-fluoro-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl (5R)-1-fluoro-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 176638856 |
| Molecular Formula | C11H19FN2O2 |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | tert-butyl (5R)-1-fluoro-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CCC1(F)CNC2 |
| InChI | InChI=1S/C11H19FN2O2/c1-10(2,3)16-9(15)14-8-4-5-11(14,12)7-13-6-8/h8,13H,4-7H2,1-3H3/t8-,11?/m1/s1 |
| InChIKey | BMYRWIBHOFOLTK-RZZZFEHKSA-N |
| XLogP | 1.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|