C14H24N2O5 — CID 175570905
tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 175570905) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 175570905 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | CC(=O)OC(C)(C)C.O=CC12CCC(CNC1)N2C(=O)O |
| InChI | InChI=1S/C8H12N2O3.C6H12O2/c11-5-8-2-1-6(3-9-4-8)10(8)7(12)13;1-5(7)8-6(2,3)4/h5-6,9H,1-4H2,(H,12,13);1-4H3 |
| InChIKey | INKWDEBBVBNZMC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|