About tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid
tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 175570905) has the molecular formula C14H24N2O5
and a molecular weight of 300.36 g/mol. Its IUPAC name is tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid.
Molecular Properties
| Compound Name | tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
| PubChem CID | 175570905 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | CC(=O)OC(C)(C)C.O=CC12CCC(CNC1)N2C(=O)O |
| InChI | InChI=1S/C8H12N2O3.C6H12O2/c11-5-8-2-1-6(3-9-4-8)10(8)7(12)13;1-5(7)8-6(2,3)4/h5-6,9H,1-4H2,(H,12,13);1-4H3 |
| InChIKey | INKWDEBBVBNZMC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid?
The IUPAC name of tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid (CID 175570905) is tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid.
What is the SMILES notation for tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid?
The canonical SMILES for tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid is CC(=O)OC(C)(C)C.O=CC12CCC(CNC1)N2C(=O)O.
What is the InChIKey of tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid?
The InChIKey is INKWDEBBVBNZMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3.C6H12O2/c11-5-8-2-1-6(3-9-4-8)10(8)7(12)13;1-5(7)8-6(2,3)4/h5-6,9H,1-4H2,(H,12,13);1-4H3.
What are the key properties of tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid?
tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid has a molecular weight of 300.36 g/mol, XLogP of 1.02, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl acetate;1-formyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid is sourced from PubChem (CID 175570905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).