About 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid
1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 175794902) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid.
Molecular Properties
| Compound Name | 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
| PubChem CID | 175794902 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | O=C(O)N1C2CCC1(CO)CNC2 |
| InChI | InChI=1S/C8H14N2O3/c11-5-8-2-1-6(3-9-4-8)10(8)7(12)13/h6,9,11H,1-5H2,(H,12,13) |
| InChIKey | FRWKVVRMUDBFFR-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid?
The IUPAC name of 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid (CID 175794902) is 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid.
What is the SMILES notation for 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid?
The canonical SMILES for 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid is O=C(O)N1C2CCC1(CO)CNC2.
What is the InChIKey of 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid?
The InChIKey is FRWKVVRMUDBFFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c11-5-8-2-1-6(3-9-4-8)10(8)7(12)13/h6,9,11H,1-5H2,(H,12,13).
What are the key properties of 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid?
1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid has a molecular weight of 186.21 g/mol, XLogP of -0.54, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(hydroxymethyl)-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid is sourced from PubChem (CID 175794902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).