C23H41N3O5 — CID 166137060
tert-butyl 1-[3-[[(2R,8R)-8-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]propoxymethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 166137060) has the molecular formula C23H41N3O5 and a molecular weight of 439.60 g/mol. Its IUPAC name is tert-butyl 1-[3-[[(2R,8R)-8-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]propoxymethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | tert-butyl 1-[3-[[(2R,8R)-8-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]propoxymethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 166137060 |
| Molecular Formula | C23H41N3O5 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | tert-butyl 1-[3-[[(2R,8R)-8-(hydroxymethyl)-1,2,3,5,6,7-hexahydropyrrolizin-2-yl]oxy]propoxymethyl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1(COCCCO[C@H]1CN3CCC[C@]3(CO)C1)CNC2 |
| InChI | InChI=1S/C23H41N3O5/c1-21(2,3)31-20(28)26-18-6-8-23(26,15-24-13-18)17-29-10-5-11-30-19-12-22(16-27)7-4-9-25(22)14-19/h18-19,24,27H,4-17H2,1-3H3/t18?,19-,22-,23?/m1/s1 |
| InChIKey | AGNWZBJSYRAIQT-PWIBJQSTSA-N |
| XLogP | 1.75 |
| TPSA | 83.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|