C12H14F9NO2 — CID 169255267
[(2R)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (PubChem CID 169255267) has the molecular formula C12H14F9NO2 and a molecular weight of 375.23 g/mol. Its IUPAC name is [(2R)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol.
| Compound Name | [(2R)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
|---|---|
| PubChem CID | 169255267 |
| Molecular Formula | C12H14F9NO2 |
| Molecular Weight | 375.23 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | [(2R)-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxy-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| SMILES | OCC12CCCN1C[C@H](OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C12H14F9NO2/c13-10(14,15)9(11(16,17)18,12(19,20)21)24-7-4-8(6-23)2-1-3-22(8)5-7/h7,23H,1-6H2/t7-,8?/m1/s1 |
| InChIKey | PCYVIYCFFLSKLC-GVHYBUMESA-N |
| XLogP | 3.03 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |