C15H23F2NO — CID 177213305
benzene;[(2S,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol;fluoromethane (PubChem CID 177213305) has the molecular formula C15H23F2NO and a molecular weight of 271.35 g/mol. Its IUPAC name is benzene;[(2S,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol;fluoromethane.
| Compound Name | benzene;[(2S,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol;fluoromethane |
|---|---|
| PubChem CID | 177213305 |
| Molecular Formula | C15H23F2NO |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | benzene;[(2S,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol;fluoromethane |
| SMILES | CF.OC[C@@]12CCCN1C[C@@H](F)C2.c1ccccc1 |
| InChI | InChI=1S/C8H14FNO.C6H6.CH3F/c9-7-4-8(6-11)2-1-3-10(8)5-7;1-2-4-6-5-3-1;1-2/h7,11H,1-6H2;1-6H;1H3/t7-,8-;;/m0../s1 |
| InChIKey | XZYYSXZZKXFPMS-FOMWZSOGSA-N |
| XLogP | 2.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |