C8H15FN2O — CID 176690420
O-[[(2S,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl]hydroxylamine (PubChem CID 176690420) has the molecular formula C8H15FN2O and a molecular weight of 174.22 g/mol. Its IUPAC name is O-[[(2S,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl]hydroxylamine.
| Compound Name | O-[[(2S,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 176690420 |
| Molecular Formula | C8H15FN2O |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | O-[[(2S,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methyl]hydroxylamine |
| SMILES | NOC[C@@]12CCCN1C[C@@H](F)C2 |
| InChI | InChI=1S/C8H15FN2O/c9-7-4-8(6-12-10)2-1-3-11(8)5-7/h7H,1-6,10H2/t7-,8-/m0/s1 |
| InChIKey | GZFPQZSCYJTICR-YUMQZZPRSA-N |
| XLogP | 0.45 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|