C13H24FN — CID 176778512
8-(3,3-dimethylbutyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 176778512) has the molecular formula C13H24FN and a molecular weight of 213.34 g/mol. Its IUPAC name is 8-(3,3-dimethylbutyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | 8-(3,3-dimethylbutyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 176778512 |
| Molecular Formula | C13H24FN |
| Molecular Weight | 213.34 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | 8-(3,3-dimethylbutyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC(C)(C)CCC12CCCN1CC(F)C2 |
| InChI | InChI=1S/C13H24FN/c1-12(2,3)6-7-13-5-4-8-15(13)10-11(14)9-13/h11H,4-10H2,1-3H3 |
| InChIKey | QUCGKDQAZYJNTH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |