C9H18FN — CID 164903957
(2R,8S)-2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine;methane (PubChem CID 164903957) has the molecular formula C9H18FN and a molecular weight of 159.25 g/mol. Its IUPAC name is (2R,8S)-2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine;methane.
| Compound Name | (2R,8S)-2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine;methane |
|---|---|
| PubChem CID | 164903957 |
| Molecular Formula | C9H18FN |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | (2R,8S)-2-fluoro-8-methyl-1,2,3,5,6,7-hexahydropyrrolizine;methane |
| SMILES | C.C[C@@]12CCCN1C[C@H](F)C2 |
| InChI | InChI=1S/C8H14FN.CH4/c1-8-3-2-4-10(8)6-7(9)5-8;/h7H,2-6H2,1H3;1H4/t7-,8+;/m1./s1 |
| InChIKey | JXAGBNVWDKZAFE-WLYNEOFISA-N |
| XLogP | 2.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |