About (2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine
(2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 170704092) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is (2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine.
Analyze (2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine?
The IUPAC name of (2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine (CID 170704092) is (2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine.
What is the SMILES notation for (2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine?
The canonical SMILES for (2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine is C[C@H]1CN2CCCC2(C)C1.
What is the InChIKey of (2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine?
The InChIKey is ILEHBHJFGRLBHR-VEDVMXKPSA-N. The full InChI is InChI=1S/C9H17N/c1-8-6-9(2)4-3-5-10(9)7-8/h8H,3-7H2,1-2H3/t8-,9?/m1/s1.
What are the key properties of (2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine?
(2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine has a molecular weight of 139.24 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,8-dimethyl-1,2,3,5,6,7-hexahydropyrrolizine is sourced from PubChem (CID 170704092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).