C8H12FNS — CID 164922203
2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carbothialdehyde (PubChem CID 164922203) has the molecular formula C8H12FNS and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carbothialdehyde.
| Compound Name | 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carbothialdehyde |
|---|---|
| PubChem CID | 164922203 |
| Molecular Formula | C8H12FNS |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine-8-carbothialdehyde |
| SMILES | FC1CN2CCCC2(C=S)C1 |
| InChI | InChI=1S/C8H12FNS/c9-7-4-8(6-11)2-1-3-10(8)5-7/h6-7H,1-5H2 |
| InChIKey | KFCPRXXUXMNVQW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|