C9H16FN — CID 163256465
(2R,8R)-8-ethyl-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 163256465) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is (2R,8R)-8-ethyl-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (2R,8R)-8-ethyl-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 163256465 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (2R,8R)-8-ethyl-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CC[C@]12CCCN1C[C@H](F)C2 |
| InChI | InChI=1S/C9H16FN/c1-2-9-4-3-5-11(9)7-8(10)6-9/h8H,2-7H2,1H3/t8-,9-/m1/s1 |
| InChIKey | FHRHYIZWASVAKH-RKDXNWHRSA-N |
| XLogP | 1.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |