C21H43FN2O2 — CID 170771438
ethane;[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol;2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethanol (PubChem CID 170771438) has the molecular formula C21H43FN2O2 and a molecular weight of 374.59 g/mol. Its IUPAC name is ethane;[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol;2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethanol.
| Compound Name | ethane;[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol;2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethanol |
|---|---|
| PubChem CID | 170771438 |
| Molecular Formula | C21H43FN2O2 |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.33 |
| IUPAC Name | ethane;[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol;2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethanol |
| SMILES | CC.CC.OCC12CCCCN1CCC2.OC[C@@]12CCCN1C[C@H](F)C2 |
| InChI | InChI=1S/C9H17NO.C8H14FNO.2C2H6/c11-8-9-4-1-2-6-10(9)7-3-5-9;9-7-4-8(6-11)2-1-3-10(8)5-7;2*1-2/h11H,1-8H2;7,11H,1-6H2;2*1-2H3/t;7-,8+;;/m.1../s1 |
| InChIKey | COKGIBJYIZBJIY-RCJQFSNMSA-N |
| XLogP | 3.60 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |