C18H34N2O4 — CID 171485202
tert-butyl 4-hydroxy-4-(2-piperidin-4-ylethoxymethyl)piperidine-1-carboxylate (PubChem CID 171485202) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-(2-piperidin-4-ylethoxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-(2-piperidin-4-ylethoxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171485202 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | tert-butyl 4-hydroxy-4-(2-piperidin-4-ylethoxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(COCCC2CCNCC2)CC1 |
| InChI | InChI=1S/C18H34N2O4/c1-17(2,3)24-16(21)20-11-7-18(22,8-12-20)14-23-13-6-15-4-9-19-10-5-15/h15,19,22H,4-14H2,1-3H3 |
| InChIKey | MSUKTVASKSWTEL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|