C11H19N2O2- — CID 134691706
1-tert-butyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 134691706) has the molecular formula C11H19N2O2- and a molecular weight of 211.28 g/mol. Its IUPAC name is 1-tert-butyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | 1-tert-butyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 134691706 |
| Molecular Formula | C11H19N2O2- |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | 1-tert-butyl-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)C12CCC(CNC1)N2C(=O)[O-] |
| InChI | InChI=1S/C11H20N2O2/c1-10(2,3)11-5-4-8(6-12-7-11)13(11)9(14)15/h8,12H,4-7H2,1-3H3,(H,14,15)/p-1 |
| InChIKey | TXYRJHDLEIIQLT-UHFFFAOYSA-M |
| XLogP | 0.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |