C15H24O4 — CID 10683339
tert-butyl (1S,2S,4S,5S,7R)-4-hydroxy-2,7-dimethyl-8-oxobicyclo[3.2.1]octane-1-carboxylate (PubChem CID 10683339) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is tert-butyl (1S,2S,4S,5S,7R)-4-hydroxy-2,7-dimethyl-8-oxobicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | tert-butyl (1S,2S,4S,5S,7R)-4-hydroxy-2,7-dimethyl-8-oxobicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 10683339 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | tert-butyl (1S,2S,4S,5S,7R)-4-hydroxy-2,7-dimethyl-8-oxobicyclo[3.2.1]octane-1-carboxylate |
| SMILES | C[C@@H]1C[C@@H]2C(=O)[C@@]1(C(=O)OC(C)(C)C)[C@@H](C)C[C@@H]2O |
| InChI | InChI=1S/C15H24O4/c1-8-6-10-11(16)7-9(2)15(8,12(10)17)13(18)19-14(3,4)5/h8-11,16H,6-7H2,1-5H3/t8-,9+,10+,11+,15+/m1/s1 |
| InChIKey | MEJPXUDJBMRRKA-YQEZVOHVSA-N |
| XLogP | 1.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|