C15H21F3O3 — CID 166440962
tert-butyl (2R,3aS,7aS)-3-oxo-2-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1H-indene-2-carboxylate (PubChem CID 166440962) has the molecular formula C15H21F3O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is tert-butyl (2R,3aS,7aS)-3-oxo-2-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1H-indene-2-carboxylate.
| Compound Name | tert-butyl (2R,3aS,7aS)-3-oxo-2-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 166440962 |
| Molecular Formula | C15H21F3O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | tert-butyl (2R,3aS,7aS)-3-oxo-2-(trifluoromethyl)-3a,4,5,6,7,7a-hexahydro-1H-indene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]1(C(F)(F)F)C[C@@H]2CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C15H21F3O3/c1-13(2,3)21-12(20)14(15(16,17)18)8-9-6-4-5-7-10(9)11(14)19/h9-10H,4-8H2,1-3H3/t9-,10-,14+/m0/s1 |
| InChIKey | AXZBHKDLUPNBDX-PKFCDNJMSA-N |
| XLogP | 3.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|