C13H21NO4 — CID 24761730
tert-butyl 2-(2-oxo-3,3a,4,5,6,7-hexahydro-1,3-benzoxazol-7a-yl)acetate (PubChem CID 24761730) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is tert-butyl 2-(2-oxo-3,3a,4,5,6,7-hexahydro-1,3-benzoxazol-7a-yl)acetate.
| Compound Name | tert-butyl 2-(2-oxo-3,3a,4,5,6,7-hexahydro-1,3-benzoxazol-7a-yl)acetate |
|---|---|
| PubChem CID | 24761730 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | tert-butyl 2-(2-oxo-3,3a,4,5,6,7-hexahydro-1,3-benzoxazol-7a-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CC12CCCCC1NC(=O)O2 |
| InChI | InChI=1S/C13H21NO4/c1-12(2,3)17-10(15)8-13-7-5-4-6-9(13)14-11(16)18-13/h9H,4-8H2,1-3H3,(H,14,16) |
| InChIKey | KTWGVHFTXVIIAD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |