C13H15F5O2 — CID 58818750
tert-butyl 3,3-difluoro-2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 58818750) has the molecular formula C13H15F5O2 and a molecular weight of 298.25 g/mol. Its IUPAC name is tert-butyl 3,3-difluoro-2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | tert-butyl 3,3-difluoro-2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 58818750 |
| Molecular Formula | C13H15F5O2 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | tert-butyl 3,3-difluoro-2-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C(F)(F)F)C2C=CC(C2)C1(F)F |
| InChI | InChI=1S/C13H15F5O2/c1-10(2,3)20-9(19)11(13(16,17)18)7-4-5-8(6-7)12(11,14)15/h4-5,7-8H,6H2,1-3H3 |
| InChIKey | AYCPPPGTAAZUOQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|