C22H24OS — CID 102426504
[(1Z)-3-[(1S,2R)-2-phenylcyclohexyl]oxybuta-1,3-dienyl]sulfanylbenzene (PubChem CID 102426504) has the molecular formula C22H24OS and a molecular weight of 336.50 g/mol. Its IUPAC name is [(1Z)-3-[(1S,2R)-2-phenylcyclohexyl]oxybuta-1,3-dienyl]sulfanylbenzene.
| Compound Name | [(1Z)-3-[(1S,2R)-2-phenylcyclohexyl]oxybuta-1,3-dienyl]sulfanylbenzene |
|---|---|
| PubChem CID | 102426504 |
| Molecular Formula | C22H24OS |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | [(1Z)-3-[(1S,2R)-2-phenylcyclohexyl]oxybuta-1,3-dienyl]sulfanylbenzene |
| SMILES | C=C(/C=C\Sc1ccccc1)O[C@H]1CCCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H24OS/c1-18(16-17-24-20-12-6-3-7-13-20)23-22-15-9-8-14-21(22)19-10-4-2-5-11-19/h2-7,10-13,16-17,21-22H,1,8-9,14-15H2/b17-16-/t21-,22+/m1/s1 |
| InChIKey | FSQFEDUUIOIVHR-AXDGSGEPSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|