C9H10O5 — CID 175248298
(2-methyl-1,3-dioxolan-2-yl) furan-3-carboxylate (PubChem CID 175248298) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is (2-methyl-1,3-dioxolan-2-yl) furan-3-carboxylate.
| Compound Name | (2-methyl-1,3-dioxolan-2-yl) furan-3-carboxylate |
|---|---|
| PubChem CID | 175248298 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | (2-methyl-1,3-dioxolan-2-yl) furan-3-carboxylate |
| SMILES | CC1(OC(=O)c2ccoc2)OCCO1 |
| InChI | InChI=1S/C9H10O5/c1-9(12-4-5-13-9)14-8(10)7-2-3-11-6-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | CGQHVOOMDMHODW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |