C25H30O8 — CID 23843941
[(1R,5S,6S,7S,9R)-7-(furan-3-carbonyloxy)-2-hydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] furan-3-carboxylate (PubChem CID 23843941) has the molecular formula C25H30O8 and a molecular weight of 458.51 g/mol. Its IUPAC name is [(1R,5S,6S,7S,9R)-7-(furan-3-carbonyloxy)-2-hydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] furan-3-carboxylate.
| Compound Name | [(1R,5S,6S,7S,9R)-7-(furan-3-carbonyloxy)-2-hydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] furan-3-carboxylate |
|---|---|
| PubChem CID | 23843941 |
| Molecular Formula | C25H30O8 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [(1R,5S,6S,7S,9R)-7-(furan-3-carbonyloxy)-2-hydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] furan-3-carboxylate |
| SMILES | CC1(C)O[C@]23C[C@H]1C[C@H](OC(=O)c1ccoc1)[C@]2(C)[C@@H](OC(=O)c1ccoc1)CCC3(C)O |
| InChI | InChI=1S/C25H30O8/c1-22(2)17-11-19(32-21(27)16-7-10-30-14-16)24(4)18(31-20(26)15-6-9-29-13-15)5-8-23(3,28)25(24,12-17)33-22/h6-7,9-10,13-14,17-19,28H,5,8,11-12H2,1-4H3/t17-,18+,19+,23?,24+,25+/m1/s1 |
| InChIKey | XTSYDGXYRUWSFF-JYGYHQQQSA-N |
| XLogP | 4.13 |
| TPSA | 108.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |