C33H38O8 — CID 162859550
[12-acetyloxy-2-hydroxy-2,6,10,10-tetramethyl-7-(3-phenylprop-2-enoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate (PubChem CID 162859550) has the molecular formula C33H38O8 and a molecular weight of 562.66 g/mol. Its IUPAC name is [12-acetyloxy-2-hydroxy-2,6,10,10-tetramethyl-7-(3-phenylprop-2-enoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate.
| Compound Name | [12-acetyloxy-2-hydroxy-2,6,10,10-tetramethyl-7-(3-phenylprop-2-enoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate |
|---|---|
| PubChem CID | 162859550 |
| Molecular Formula | C33H38O8 |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | [12-acetyloxy-2-hydroxy-2,6,10,10-tetramethyl-7-(3-phenylprop-2-enoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate |
| SMILES | CC(=O)OC1C2CC(OC(=O)C=Cc3ccccc3)C3(C)C(OC(=O)c4ccccc4)CCC(C)(O)C13OC2(C)C |
| InChI | InChI=1S/C33H38O8/c1-21(34)38-28-24-20-26(39-27(35)17-16-22-12-8-6-9-13-22)32(5)25(40-29(36)23-14-10-7-11-15-23)18-19-31(4,37)33(28,32)41-30(24,2)3/h6-17,24-26,28,37H,18-20H2,1-5H3 |
| InChIKey | AFEWHYCXQNOABF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|