C28H36O9 — CID 162904169
[(1S,2R,5R,6R,7S,9R,12S)-12-acetyloxy-2-hydroxy-5-(2-hydroxyacetyl)oxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] (Z)-3-phenylprop-2-enoate (PubChem CID 162904169) has the molecular formula C28H36O9 and a molecular weight of 516.59 g/mol. Its IUPAC name is [(1S,2R,5R,6R,7S,9R,12S)-12-acetyloxy-2-hydroxy-5-(2-hydroxyacetyl)oxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] (Z)-3-phenylprop-2-enoate.
| Compound Name | [(1S,2R,5R,6R,7S,9R,12S)-12-acetyloxy-2-hydroxy-5-(2-hydroxyacetyl)oxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] (Z)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162904169 |
| Molecular Formula | C28H36O9 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | [(1S,2R,5R,6R,7S,9R,12S)-12-acetyloxy-2-hydroxy-5-(2-hydroxyacetyl)oxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] (Z)-3-phenylprop-2-enoate |
| SMILES | CC(=O)O[C@H]1[C@H]2C[C@H](OC(=O)/C=C\c3ccccc3)[C@@]3(C)[C@H](OC(=O)CO)CC[C@@](C)(O)[C@@]13OC2(C)C |
| InChI | InChI=1S/C28H36O9/c1-17(30)34-24-19-15-21(36-22(31)12-11-18-9-7-6-8-10-18)27(5)20(35-23(32)16-29)13-14-26(4,33)28(24,27)37-25(19,2)3/h6-12,19-21,24,29,33H,13-16H2,1-5H3/b12-11-/t19-,20-,21+,24+,26-,27-,28+/m1/s1 |
| InChIKey | ZBLCWCJBUVYIBX-SQSYVPSMSA-N |
| XLogP | 2.57 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|