C33H38O11 — CID 162938251
[(1S,2S,5S,6S,7R,9R,12R)-12-acetyloxy-6-(acetyloxymethyl)-2-hydroxy-2,10,10-trimethyl-7-(3-phenylprop-2-enoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] furan-3-carboxylate (PubChem CID 162938251) has the molecular formula C33H38O11 and a molecular weight of 610.66 g/mol. Its IUPAC name is [(1S,2S,5S,6S,7R,9R,12R)-12-acetyloxy-6-(acetyloxymethyl)-2-hydroxy-2,10,10-trimethyl-7-(3-phenylprop-2-enoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] furan-3-carboxylate.
| Compound Name | [(1S,2S,5S,6S,7R,9R,12R)-12-acetyloxy-6-(acetyloxymethyl)-2-hydroxy-2,10,10-trimethyl-7-(3-phenylprop-2-enoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] furan-3-carboxylate |
|---|---|
| PubChem CID | 162938251 |
| Molecular Formula | C33H38O11 |
| Molecular Weight | 610.66 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | [(1S,2S,5S,6S,7R,9R,12R)-12-acetyloxy-6-(acetyloxymethyl)-2-hydroxy-2,10,10-trimethyl-7-(3-phenylprop-2-enoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] furan-3-carboxylate |
| SMILES | CC(=O)OC[C@@]12[C@@H](OC(=O)c3ccoc3)CC[C@](C)(O)[C@]13OC(C)(C)[C@H](C[C@H]2OC(=O)C=Cc1ccccc1)[C@H]3OC(C)=O |
| InChI | InChI=1S/C33H38O11/c1-20(34)40-19-32-25(43-29(37)23-14-16-39-18-23)13-15-31(5,38)33(32)28(41-21(2)35)24(30(3,4)44-33)17-26(32)42-27(36)12-11-22-9-7-6-8-10-22/h6-12,14,16,18,24-26,28,38H,13,15,17,19H2,1-5H3/t24-,25+,26-,28-,31+,32+,33+/m1/s1 |
| InChIKey | ZYDOFCQFZCENDE-DDHAMGGJSA-N |
| XLogP | 4.02 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|