C32H40O12 — CID 163193494
[(1S,2S,4S,5R,6R,7S,9R,12R)-4,12-diacetyloxy-5-(2-acetyloxyacetyl)oxy-2-hydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] (E)-3-phenylprop-2-enoate (PubChem CID 163193494) has the molecular formula C32H40O12 and a molecular weight of 616.66 g/mol. Its IUPAC name is [(1S,2S,4S,5R,6R,7S,9R,12R)-4,12-diacetyloxy-5-(2-acetyloxyacetyl)oxy-2-hydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1S,2S,4S,5R,6R,7S,9R,12R)-4,12-diacetyloxy-5-(2-acetyloxyacetyl)oxy-2-hydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 163193494 |
| Molecular Formula | C32H40O12 |
| Molecular Weight | 616.66 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | [(1S,2S,4S,5R,6R,7S,9R,12R)-4,12-diacetyloxy-5-(2-acetyloxyacetyl)oxy-2-hydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-7-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CC(=O)OCC(=O)O[C@H]1[C@@H](OC(C)=O)C[C@](C)(O)[C@]23OC(C)(C)[C@H](C[C@H](OC(=O)/C=C/c4ccccc4)[C@]12C)[C@H]3OC(C)=O |
| InChI | InChI=1S/C32H40O12/c1-18(33)39-17-26(37)43-28-23(40-19(2)34)16-30(6,38)32-27(41-20(3)35)22(29(4,5)44-32)15-24(31(28,32)7)42-25(36)14-13-21-11-9-8-10-12-21/h8-14,22-24,27-28,38H,15-17H2,1-7H3/b14-13+/t22-,23+,24+,27-,28+,30+,31-,32+/m1/s1 |
| InChIKey | LBTXJSJJVPLKCA-FPXNBKRGSA-N |
| XLogP | 2.68 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.66 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|