C32H40O13 — CID 162972722
[7,8,12-triacetyloxy-6-(acetyloxymethyl)-2,4-dihydroxy-2,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] 3-phenylprop-2-enoate (PubChem CID 162972722) has the molecular formula C32H40O13 and a molecular weight of 632.66 g/mol. Its IUPAC name is [7,8,12-triacetyloxy-6-(acetyloxymethyl)-2,4-dihydroxy-2,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] 3-phenylprop-2-enoate.
| Compound Name | [7,8,12-triacetyloxy-6-(acetyloxymethyl)-2,4-dihydroxy-2,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162972722 |
| Molecular Formula | C32H40O13 |
| Molecular Weight | 632.66 g/mol |
| Exact Mass | 632.25 |
| IUPAC Name | [7,8,12-triacetyloxy-6-(acetyloxymethyl)-2,4-dihydroxy-2,10,10-trimethyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] 3-phenylprop-2-enoate |
| SMILES | CC(=O)OCC12C(OC(=O)C=Cc3ccccc3)C(O)CC(C)(O)C13OC(C)(C)C(C(OC(C)=O)C2OC(C)=O)C3OC(C)=O |
| InChI | InChI=1S/C32H40O13/c1-17(33)40-16-31-26(44-23(38)14-13-21-11-9-8-10-12-21)22(37)15-30(7,39)32(31)27(42-19(3)35)24(29(5,6)45-32)25(41-18(2)34)28(31)43-20(4)36/h8-14,22,24-28,37,39H,15-16H2,1-7H3 |
| InChIKey | WFFRIURTLDKLQR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.66 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|