C28H36O9 — CID 162973141
(7,12-diacetyloxy-2,4-dihydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl) 3-phenylprop-2-enoate (PubChem CID 162973141) has the molecular formula C28H36O9 and a molecular weight of 516.59 g/mol. Its IUPAC name is (7,12-diacetyloxy-2,4-dihydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl) 3-phenylprop-2-enoate.
| Compound Name | (7,12-diacetyloxy-2,4-dihydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162973141 |
| Molecular Formula | C28H36O9 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | (7,12-diacetyloxy-2,4-dihydroxy-2,6,10,10-tetramethyl-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl) 3-phenylprop-2-enoate |
| SMILES | CC(=O)OC1CC2C(OC(C)=O)C3(OC2(C)C)C(C)(O)CC(O)C(OC(=O)C=Cc2ccccc2)C13C |
| InChI | InChI=1S/C28H36O9/c1-16(29)34-21-14-19-23(35-17(2)30)28(37-25(19,3)4)26(5,33)15-20(31)24(27(21,28)6)36-22(32)13-12-18-10-8-7-9-11-18/h7-13,19-21,23-24,31,33H,14-15H2,1-6H3 |
| InChIKey | FLZISSGGAGGMDS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|