C33H38O10 — CID 162930820
[(1S,2S,3S,4R,5R,6R,7S,9R,12R)-4-acetyloxy-2,3,12-trihydroxy-2,6,10,10-tetramethyl-7-(3-phenylprop-2-enoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate (PubChem CID 162930820) has the molecular formula C33H38O10 and a molecular weight of 594.66 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5R,6R,7S,9R,12R)-4-acetyloxy-2,3,12-trihydroxy-2,6,10,10-tetramethyl-7-(3-phenylprop-2-enoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate.
| Compound Name | [(1S,2S,3S,4R,5R,6R,7S,9R,12R)-4-acetyloxy-2,3,12-trihydroxy-2,6,10,10-tetramethyl-7-(3-phenylprop-2-enoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate |
|---|---|
| PubChem CID | 162930820 |
| Molecular Formula | C33H38O10 |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | [(1S,2S,3S,4R,5R,6R,7S,9R,12R)-4-acetyloxy-2,3,12-trihydroxy-2,6,10,10-tetramethyl-7-(3-phenylprop-2-enoyloxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] benzoate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(=O)c2ccccc2)[C@@]2(C)[C@@H](OC(=O)C=Cc3ccccc3)C[C@@H]3[C@@H](O)[C@]2(OC3(C)C)[C@@](C)(O)[C@H]1O |
| InChI | InChI=1S/C33H38O10/c1-19(34)40-25-27(37)32(5,39)33-26(36)22(30(2,3)43-33)18-23(41-24(35)17-16-20-12-8-6-9-13-20)31(33,4)28(25)42-29(38)21-14-10-7-11-15-21/h6-17,22-23,25-28,36-37,39H,18H2,1-5H3/t22-,23+,25-,26-,27+,28+,31-,32+,33-/m1/s1 |
| InChIKey | FVTRWXQLJLCVKD-ZDEFVMGHSA-N |
| XLogP | 2.83 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|