C35H40O7 — CID 163077572
[(1S,2R,4S,5R,6R,7R,9R)-5-acetyloxy-2,6,10,10-tetramethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-4-yl] (E)-3-phenylprop-2-enoate (PubChem CID 163077572) has the molecular formula C35H40O7 and a molecular weight of 572.70 g/mol. Its IUPAC name is [(1S,2R,4S,5R,6R,7R,9R)-5-acetyloxy-2,6,10,10-tetramethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-4-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1S,2R,4S,5R,6R,7R,9R)-5-acetyloxy-2,6,10,10-tetramethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-4-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 163077572 |
| Molecular Formula | C35H40O7 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | [(1S,2R,4S,5R,6R,7R,9R)-5-acetyloxy-2,6,10,10-tetramethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-4-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(=O)/C=C/c2ccccc2)C[C@@H](C)[C@@]23C[C@@H](C[C@@H](OC(=O)/C=C/c4ccccc4)[C@]12C)C(C)(C)O3 |
| InChI | InChI=1S/C35H40O7/c1-23-20-28(40-30(37)18-16-25-12-8-6-9-13-25)32(39-24(2)36)34(5)29(21-27-22-35(23,34)42-33(27,3)4)41-31(38)19-17-26-14-10-7-11-15-26/h6-19,23,27-29,32H,20-22H2,1-5H3/b18-16+,19-17+/t23-,27-,28+,29-,32+,34-,35+/m1/s1 |
| InChIKey | AHOFVTNVINYGSD-PHXWKNBZSA-N |
| XLogP | 6.17 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|