C31H42O7 — CID 163194092
[(1S,2R,4S,5R,6R,7S,9R)-5-acetyloxy-2,6,10,10-tetramethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-4-yl] (2R)-2-methylbutanoate (PubChem CID 163194092) has the molecular formula C31H42O7 and a molecular weight of 526.67 g/mol. Its IUPAC name is [(1S,2R,4S,5R,6R,7S,9R)-5-acetyloxy-2,6,10,10-tetramethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-4-yl] (2R)-2-methylbutanoate.
| Compound Name | [(1S,2R,4S,5R,6R,7S,9R)-5-acetyloxy-2,6,10,10-tetramethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-4-yl] (2R)-2-methylbutanoate |
|---|---|
| PubChem CID | 163194092 |
| Molecular Formula | C31H42O7 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | [(1S,2R,4S,5R,6R,7S,9R)-5-acetyloxy-2,6,10,10-tetramethyl-7-[(E)-3-phenylprop-2-enoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-4-yl] (2R)-2-methylbutanoate |
| SMILES | CC[C@@H](C)C(=O)O[C@H]1C[C@@H](C)[C@@]23C[C@@H](C[C@H](OC(=O)/C=C/c4ccccc4)[C@]2(C)[C@H]1OC(C)=O)C(C)(C)O3 |
| InChI | InChI=1S/C31H42O7/c1-8-19(2)28(34)36-24-16-20(3)31-18-23(29(5,6)38-31)17-25(30(31,7)27(24)35-21(4)32)37-26(33)15-14-22-12-10-9-11-13-22/h9-15,19-20,23-25,27H,8,16-18H2,1-7H3/b15-14+/t19-,20-,23-,24+,25+,27+,30-,31+/m1/s1 |
| InChIKey | NVFCLOIFOWKEPZ-KQVVARBWSA-N |
| XLogP | 5.50 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|