C24H32O5 — CID 163014773
[(1R,2R,5S,6R,7S,9R)-2-hydroxy-6,10,10-trimethyl-7-(2-phenylethenoxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] acetate (PubChem CID 163014773) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is [(1R,2R,5S,6R,7S,9R)-2-hydroxy-6,10,10-trimethyl-7-(2-phenylethenoxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] acetate.
| Compound Name | [(1R,2R,5S,6R,7S,9R)-2-hydroxy-6,10,10-trimethyl-7-(2-phenylethenoxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] acetate |
|---|---|
| PubChem CID | 163014773 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [(1R,2R,5S,6R,7S,9R)-2-hydroxy-6,10,10-trimethyl-7-(2-phenylethenoxy)-11-oxatricyclo[7.2.1.01,6]dodecan-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@H](O)[C@@]23C[C@@H](C[C@H](OC=Cc4ccccc4)[C@]12C)C(C)(C)O3 |
| InChI | InChI=1S/C24H32O5/c1-16(25)28-20-11-10-19(26)24-15-18(22(2,3)29-24)14-21(23(20,24)4)27-13-12-17-8-6-5-7-9-17/h5-9,12-13,18-21,26H,10-11,14-15H2,1-4H3/t18-,19-,20+,21+,23+,24+/m1/s1 |
| InChIKey | YHIPIHWCMHCVMP-XCUVIRGDSA-N |
| XLogP | 4.09 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|