C36H44O11 — CID 163049015
[(1S,2S,4S,5R,6S,7R,8R,9S,12R)-5-acetyloxy-7-benzoyloxy-2,12-dihydroxy-2,6,10,10-tetramethyl-4-[(2R)-2-methylbutanoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-8-yl] benzoate (PubChem CID 163049015) has the molecular formula C36H44O11 and a molecular weight of 652.74 g/mol. Its IUPAC name is [(1S,2S,4S,5R,6S,7R,8R,9S,12R)-5-acetyloxy-7-benzoyloxy-2,12-dihydroxy-2,6,10,10-tetramethyl-4-[(2R)-2-methylbutanoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-8-yl] benzoate.
| Compound Name | [(1S,2S,4S,5R,6S,7R,8R,9S,12R)-5-acetyloxy-7-benzoyloxy-2,12-dihydroxy-2,6,10,10-tetramethyl-4-[(2R)-2-methylbutanoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-8-yl] benzoate |
|---|---|
| PubChem CID | 163049015 |
| Molecular Formula | C36H44O11 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | [(1S,2S,4S,5R,6S,7R,8R,9S,12R)-5-acetyloxy-7-benzoyloxy-2,12-dihydroxy-2,6,10,10-tetramethyl-4-[(2R)-2-methylbutanoyl]oxy-11-oxatricyclo[7.2.1.01,6]dodecan-8-yl] benzoate |
| SMILES | CC[C@@H](C)C(=O)O[C@H]1C[C@](C)(O)[C@]23OC(C)(C)[C@H]([C@@H](OC(=O)c4ccccc4)[C@H](OC(=O)c4ccccc4)[C@]2(C)[C@H]1OC(C)=O)[C@H]3O |
| InChI | InChI=1S/C36H44O11/c1-8-20(2)30(39)44-24-19-34(6,42)36-27(38)25(33(4,5)47-36)26(45-31(40)22-15-11-9-12-16-22)29(35(36,7)28(24)43-21(3)37)46-32(41)23-17-13-10-14-18-23/h9-18,20,24-29,38,42H,8,19H2,1-7H3/t20-,24+,25-,26-,27-,28+,29+,34+,35+,36+/m1/s1 |
| InChIKey | MZPFKJUEPOCQPK-DRVTWEEMSA-N |
| XLogP | 4.03 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|